ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
| produktnavn |
2-Bromo-5-iodotoluene |
| Synonymer |
1-bromo-4-iodo-2-methylbenzene |
| Molekylær Formel |
C7H6BrI |
| Molekylvekt |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| CAS-nummer |
202865-85-8 |
| Molecular Structure |
|
| Tetthet |
2.062g/cm3 |
| Kokepunkt |
264.2°C at 760 mmHg |
| Brytningsindeks |
1.636 |
| Flammepunktet |
113.6°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
