ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
produktnavn |
3-Chloro-4-fluoroanisole |
Synonymer |
2-chloro-1-fluoro-4-methoxybenzene |
Molekylær Formel |
C7H6ClFO |
Molekylvekt |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
CAS-nummer |
202925-07-3 |
Molecular Structure |
|
Tetthet |
1.239g/cm3 |
Kokepunkt |
202.8°C at 760 mmHg |
Brytningsindeks |
1.495 |
Flammepunktet |
76.4°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|