ChemNet > CAS > 21327-86-6 2-Chloro-6-Methylbenzoic Acid
21327-86-6 2-Chloro-6-Methylbenzoic Acid
produktnavn |
2-Chloro-6-Methylbenzoic Acid |
Synonymer |
6-Chloro-o-toluic acid (COOH=1); 6-Chloro-o-toluic acid; Benzoic acid,2-chloro-6-methyl-; 2-Choro-6-methyl-benzoic acid |
Molekylær Formel |
C8H7ClO2 |
Molekylvekt |
170.593 |
InChI |
InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS-nummer |
21327-86-6 |
Molecular Structure |
|
Tetthet |
1.31g/cm3 |
Kokepunkt |
289.9°C at 760 mmHg |
Brytningsindeks |
1.573 |
Flammepunktet |
129.2°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|