ChemNet > CAS > 216393-67-8 4-Chloro-2-fluoro-6-iodoaniline
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline
produktnavn |
4-Chloro-2-fluoro-6-iodoaniline |
Molekylær Formel |
C6H4ClFIN |
Molekylvekt |
271.4585 |
InChI |
InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS-nummer |
216393-67-8 |
Molecular Structure |
|
Tetthet |
2.089g/cm3 |
Kokepunkt |
267.4°C at 760 mmHg |
Brytningsindeks |
1.665 |
Flammepunktet |
115.5°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|