ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
produktnavn |
4-Chloro-alpha-methylphenylacetonitrile |
Synonymer |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
Molekylær Formel |
C9H8ClN |
Molekylvekt |
165.6195 |
InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
CAS-nummer |
2184-88-5 |
EINECS |
218-569-0 |
Molecular Structure |
|
Tetthet |
1.143g/cm3 |
Kokepunkt |
260.3°C at 760 mmHg |
Brytningsindeks |
1.537 |
Flammepunktet |
104°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|