ChemNet > CAS > 2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
2184-88-5 4-Chloro-alpha-methylphenylacetonitrile
| produktnavn |
4-Chloro-alpha-methylphenylacetonitrile |
| Synonymer |
2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| Molekylær Formel |
C9H8ClN |
| Molekylvekt |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| CAS-nummer |
2184-88-5 |
| EINECS |
218-569-0 |
| Molecular Structure |
|
| Tetthet |
1.143g/cm3 |
| Kokepunkt |
260.3°C at 760 mmHg |
| Brytningsindeks |
1.537 |
| Flammepunktet |
104°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
