ChemNet > CAS > 219492-12-3 3-(Benzyloxy)-4-methylphenylamine
219492-12-3 3-(Benzyloxy)-4-methylphenylamine
produktnavn |
3-(Benzyloxy)-4-methylphenylamine |
Synonymer |
3-(benzyloxy)-4-methylaniline |
Molekylær Formel |
C14H15NO |
Molekylvekt |
213.275 |
InChI |
InChI=1/C14H15NO/c1-11-7-8-13(15)9-14(11)16-10-12-5-3-2-4-6-12/h2-9H,10,15H2,1H3 |
CAS-nummer |
219492-12-3 |
Molecular Structure |
|
Tetthet |
1.106g/cm3 |
Kokepunkt |
369.3°C at 760 mmHg |
Brytningsindeks |
1.606 |
Flammepunktet |
184.1°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|