ChemNet > CAS > 2216-94-6 Ethyl phenylpropiolate
2216-94-6 Ethyl phenylpropiolate
produktnavn |
Ethyl phenylpropiolate |
Synonymer |
Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
Molekylær Formel |
C11H10O2 |
Molekylvekt |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
CAS-nummer |
2216-94-6 |
EINECS |
218-703-8 |
Molecular Structure |
|
Tetthet |
1.09g/cm3 |
Kokepunkt |
265°C at 760 mmHg |
Brytningsindeks |
1.538 |
Flammepunktet |
124.9°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|