ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
produktnavn |
1,3-Difluoro-5-iodobenzene |
Synonymer |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
Molekylær Formel |
C6H3F2I |
Molekylvekt |
239.9893 |
InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
CAS-nummer |
2265-91-0 |
Molecular Structure |
|
Tetthet |
2.001g/cm3 |
Kokepunkt |
173.9°C at 760 mmHg |
Brytningsindeks |
1.566 |
Flammepunktet |
63.8°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|