ChemNet > CAS > 22884-95-3 3,4-Dimethylbenzonitrile
22884-95-3 3,4-Dimethylbenzonitrile
produktnavn |
3,4-Dimethylbenzonitrile |
Synonymer |
Benzonitrile, 3,4-dimethyl-; 0-09-00-00536 (Beilstein Handbook Reference); BRN 0970523 |
Molekylær Formel |
C9H9N |
Molekylvekt |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,1-2H3 |
CAS-nummer |
22884-95-3 |
EINECS |
245-293-8 |
Molecular Structure |
|
Tetthet |
0.99g/cm3 |
Smeltepunkt |
64-66℃ |
Kokepunkt |
253.5°C at 760 mmHg |
Brytningsindeks |
1.525 |
Flammepunktet |
107.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|