ChemNet > CAS > 2338-71-8 5-fluoroindole-3-carboxaldehyde
2338-71-8 5-fluoroindole-3-carboxaldehyde
produktnavn |
5-fluoroindole-3-carboxaldehyde |
Synonymer |
5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
Molekylær Formel |
C9H6FNO |
Molekylvekt |
163.1484 |
InChI |
InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
CAS-nummer |
2338-71-8 |
Molecular Structure |
|
Tetthet |
1.385g/cm3 |
Kokepunkt |
342.4°C at 760 mmHg |
Brytningsindeks |
1.695 |
Flammepunktet |
160.9°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|