ChemNet > CAS > 2362-64-3 4-Methoxythiobenzamide
2362-64-3 4-Methoxythiobenzamide
| produktnavn |
4-Methoxythiobenzamide |
| Synonymer |
Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
| Molekylær Formel |
C8H9NOS |
| Molekylvekt |
167.2282 |
| InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
| CAS-nummer |
2362-64-3 |
| Molecular Structure |
|
| Tetthet |
1.194g/cm3 |
| Kokepunkt |
288.5°C at 760 mmHg |
| Brytningsindeks |
1.619 |
| Flammepunktet |
128.3°C |
| Hazard symboler |
|
| Risiko Koder |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
