ChemNet > CAS > 2401-24-3 6-Chloro-m-anisidine
2401-24-3 6-Chloro-m-anisidine
| produktnavn |
6-Chloro-m-anisidine |
| Synonymer |
2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
| Molekylær Formel |
C7H9Cl2NO |
| Molekylvekt |
194.0585 |
| InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
| CAS-nummer |
2401-24-3 |
| EINECS |
219-277-6 |
| Molecular Structure |
|
| Smeltepunkt |
207℃ |
| Kokepunkt |
255°C at 760 mmHg |
| Flammepunktet |
108°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
