ChemNet > CAS > 245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
produktnavn |
2,3-Difluoro-4-methylbenzaldehyde |
Synonymer |
2,3-Difluoro-p-tolualdehyde |
Molekylær Formel |
C8H6F2O |
Molekylvekt |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5-2-3-6(4-11)8(10)7(5)9/h2-4H,1H3 |
CAS-nummer |
245536-50-9 |
Molecular Structure |
|
Tetthet |
1.241g/cm3 |
Kokepunkt |
204.2°C at 760 mmHg |
Brytningsindeks |
1.513 |
Flammepunktet |
76.1°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|