ChemNet > CAS > 24800-44-0 Tripropylene glycol
24800-44-0 Tripropylene glycol
| produktnavn |
Tripropylene glycol |
| Synonymer |
Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
| Molekylær Formel |
C9H20O4 |
| Molekylvekt |
192.2527 |
| InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
| CAS-nummer |
24800-44-0 |
| EINECS |
246-466-0 |
| Molecular Structure |
|
| Tetthet |
1.038g/cm3 |
| Kokepunkt |
316.1°C at 760 mmHg |
| Brytningsindeks |
1.455 |
| Flammepunktet |
145°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
