ChemNet > CAS > 24932-48-7 4,5-Dibromo-o-xylene
24932-48-7 4,5-Dibromo-o-xylene
produktnavn |
4,5-Dibromo-o-xylene |
Synonymer |
1,2-Dibromo-4,5-dimethylbenzene |
Molekylær Formel |
C8H8Br2 |
Molekylvekt |
263.9571 |
InChI |
InChI=1/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
CAS-nummer |
24932-48-7 |
Molecular Structure |
|
Tetthet |
1.71g/cm3 |
Kokepunkt |
279.1°C at 760 mmHg |
Brytningsindeks |
1.578 |
Flammepunktet |
138.7°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|