ChemNet > CAS > 24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
produktnavn |
Ethyl 5-hydroxyindole-2-carboxylate |
Synonymer |
5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
Molekylær Formel |
C13H19NO |
Molekylvekt |
205.2961 |
InChI |
InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
CAS-nummer |
24985-85-1 |
EINECS |
246-554-9 |
Molecular Structure |
|
Tetthet |
1.056g/cm3 |
Kokepunkt |
294.068°C at 760 mmHg |
Brytningsindeks |
1.551 |
Flammepunktet |
123.378°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|