ChemNet > CAS > 2510-55-6 9-Cyanophenanthrene
2510-55-6 9-Cyanophenanthrene
produktnavn |
9-Cyanophenanthrene |
Synonymer |
Cyanophenanthrene; phenanthrene-9-carbonitrile |
Molekylær Formel |
C15H9N |
Molekylvekt |
203.2387 |
InChI |
InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
CAS-nummer |
2510-55-6 |
EINECS |
219-725-0 |
Molecular Structure |
|
Tetthet |
1.2g/cm3 |
Smeltepunkt |
110-112℃ |
Kokepunkt |
413.8°C at 760 mmHg |
Brytningsindeks |
1.719 |
Flammepunktet |
205.4°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|