ChemNet > CAS > 261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
261762-39-4 2-Chloro-3,6-difluorobenzaldehyde
produktnavn |
2-Chloro-3,6-difluorobenzaldehyde |
Molekylær Formel |
C7H3ClF2O |
Molekylvekt |
176.5479 |
InChI |
InChI=1/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
CAS-nummer |
261762-39-4 |
Molecular Structure |
|
Tetthet |
1.453g/cm3 |
Smeltepunkt |
46-50℃ |
Kokepunkt |
206.4°C at 760 mmHg |
Brytningsindeks |
1.536 |
Flammepunktet |
78.6°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|