CAS No: 27137-33-3, Chemical Name: 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-ol
the physical and chemical property of 27137-33-3, 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-ol is provided by ChemNet.com
ChemNet > CAS > 27137-33-3 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-ol
27137-33-3 3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-ol
| produktnavn |
3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-1-ol |
| Synonymer |
248-252-2; 4,7-methano-1H-inden-1-ol, 3a,4,5,6,7,7a-hexahydro-; 4,7-Methano-1H-indenol, 3a,4,5,6,7,7a-hexahydro-; Tricyclo[5.2.1.02,6]dec-4-en-3-ol; Dihydrodicyclopentadiene; Dicyclopentenyl Alcohol |
| Molekylær Formel |
C10H14O |
| Molekylvekt |
150.2176 |
| InChI |
InChI=1/C10H14O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h3-4,6-11H,1-2,5H2 |
| CAS-nummer |
27137-33-3 |
| EINECS |
248-252-2 |
| Molecular Structure |
|
| Tetthet |
1.157g/cm3 |
| Kokepunkt |
251.1°C at 760 mmHg |
| Brytningsindeks |
1.583 |
| Flammepunktet |
91.7°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
