ChemNet > CAS > 2719-15-5 2-Methyl-4-nitroacetanilide
2719-15-5 2-Methyl-4-nitroacetanilide
produktnavn |
2-Methyl-4-nitroacetanilide |
Synonymer |
N1-(2-Methyl-4-nitrophenyl)acetamide; N-(2-methyl-4-nitrophenyl)acetamide |
Molekylær Formel |
C9H10N2O3 |
Molekylvekt |
194.1873 |
InChI |
InChI=1/C9H10N2O3/c1-6-5-8(11(13)14)3-4-9(6)10-7(2)12/h3-5H,1-2H3,(H,10,12) |
CAS-nummer |
2719-15-5 |
Molecular Structure |
|
Tetthet |
1.289g/cm3 |
Smeltepunkt |
198-200℃ |
Kokepunkt |
393.3°C at 760 mmHg |
Brytningsindeks |
1.605 |
Flammepunktet |
191.7°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|