ChemNet > CAS > 2777-65-3 10-Undecynoic acid
2777-65-3 10-Undecynoic acid
produktnavn |
10-Undecynoic acid |
Molekylær Formel |
C11H18O2 |
Molekylvekt |
182.2594 |
InChI |
InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
CAS-nummer |
2777-65-3 |
EINECS |
220-471-8 |
Molecular Structure |
|
Tetthet |
0.966g/cm3 |
Kokepunkt |
297.7°C at 760 mmHg |
Brytningsindeks |
1.468 |
Flammepunktet |
142.9°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|