ChemNet > CAS > 287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
produktnavn |
4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde |
Molekylær Formel |
C5H5BrN2O |
Molekylvekt |
189.01 |
InChI |
InChI=1/C5H5BrN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3 |
CAS-nummer |
287917-96-8 |
Molecular Structure |
|
Tetthet |
1.73g/cm3 |
Smeltepunkt |
68℃ |
Kokepunkt |
275.2°C at 760 mmHg |
Brytningsindeks |
1.621 |
Flammepunktet |
120.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|