ChemNet > CAS > 29840-73-1 2-Bromopyridine-4-carboxamide
29840-73-1 2-Bromopyridine-4-carboxamide
| produktnavn |
2-Bromopyridine-4-carboxamide |
| Synonymer |
2-Bromoisonicotinamide |
| Molekylær Formel |
C6H5BrN2O |
| Molekylvekt |
201.0207 |
| InChI |
InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS-nummer |
29840-73-1 |
| Molecular Structure |
|
| Tetthet |
1.71g/cm3 |
| Kokepunkt |
338.1°C at 760 mmHg |
| Brytningsindeks |
1.613 |
| Flammepunktet |
158.3°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
