ChemNet > CAS > 3019-20-3 Isopropylthiobenzene
3019-20-3 Isopropylthiobenzene
produktnavn |
Isopropylthiobenzene |
Synonymer |
(Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
Molekylær Formel |
C9H12S |
Molekylvekt |
152.2566 |
InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
CAS-nummer |
3019-20-3 |
EINECS |
221-162-0 |
Molecular Structure |
|
Tetthet |
0.98g/cm3 |
Kokepunkt |
208°C at 760 mmHg |
Brytningsindeks |
1.544 |
Flammepunktet |
83.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|