ChemNet > CAS > 3034-19-3 2-Nitrophenylhydrazine
3034-19-3 2-Nitrophenylhydrazine
| produktnavn |
2-Nitrophenylhydrazine |
| Synonymer |
BRN 0512797; Hydrazine, (o-nitrophenyl)- |
| Molekylær Formel |
C6H7N3O2 |
| Molekylvekt |
153.1387 |
| InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
| CAS-nummer |
3034-19-3 |
| EINECS |
221-222-6 |
| Molecular Structure |
|
| Tetthet |
1.419g/cm3 |
| Smeltepunkt |
89-94℃ |
| Kokepunkt |
314.3°C at 760 mmHg |
| Brytningsindeks |
1.691 |
| Flammepunktet |
143.9°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
