ChemNet > CAS > 31874-34-7 2,4-Dimethoxybenzaldoxime
31874-34-7 2,4-Dimethoxybenzaldoxime
produktnavn |
2,4-Dimethoxybenzaldoxime |
Synonymer |
1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
Molekylær Formel |
C9H11NO3 |
Molekylvekt |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
CAS-nummer |
31874-34-7 |
Molecular Structure |
|
Tetthet |
1.11g/cm3 |
Kokepunkt |
304.9°C at 760 mmHg |
Brytningsindeks |
1.501 |
Flammepunktet |
138.2°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|