ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
produktnavn |
3-fluoro-4-methoxybenzonitrile |
Synonymer |
Fluoromethoxybenzonitrile |
Molekylær Formel |
C8H6FNO |
Molekylvekt |
151.1377 |
InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS-nummer |
331-62-4 |
Molecular Structure |
|
Tetthet |
1.18g/cm3 |
Kokepunkt |
254.3°C at 760 mmHg |
Brytningsindeks |
1.505 |
Flammepunktet |
107.6°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|