ChemNet > CAS > 3325-11-9 5-Aminobenzotriazole
3325-11-9 5-Aminobenzotriazole
produktnavn |
5-Aminobenzotriazole |
Synonymer |
1H-Benzotriazol-6-amine; 1H-Benzotriazol-5-amine; 2H-benzotriazol-5-amine |
Molekylær Formel |
C6H6N4 |
Molekylvekt |
134.1386 |
InChI |
InChI=1/C6H6N4/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,7H2,(H,8,9,10) |
CAS-nummer |
3325-11-9 |
Molecular Structure |
|
Tetthet |
1.48g/cm3 |
Kokepunkt |
387.4°C at 760 mmHg |
Brytningsindeks |
1.806 |
Flammepunktet |
216.5°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|