ChemNet > CAS > 33901-44-9 4-Methylphenoxyacetonitrile
33901-44-9 4-Methylphenoxyacetonitrile
produktnavn |
4-Methylphenoxyacetonitrile |
Molekylær Formel |
C9H9NO |
Molekylvekt |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,7H2,1H3 |
CAS-nummer |
33901-44-9 |
Molecular Structure |
|
Tetthet |
1.054g/cm3 |
Kokepunkt |
262.5°C at 760 mmHg |
Brytningsindeks |
1.517 |
Flammepunktet |
109.8°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|