ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
produktnavn |
Pentamethylphenylacetonitrile |
Synonymer |
2,3,4,5,6-Pentamethylbenzyl cyanide |
Molekylær Formel |
C13H17N |
Molekylvekt |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS-nummer |
34688-70-5 |
Molecular Structure |
|
Tetthet |
0.95g/cm3 |
Smeltepunkt |
105-107℃ |
Kokepunkt |
325.9°C at 760 mmHg |
Brytningsindeks |
1.519 |
Flammepunktet |
160.2°C |
Hazard symboler |
|
Risiko Koder |
R20/22:Harmful by inhalation and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|