ChemNet > CAS > 34803-68-4 1-(2-Pyrazinyl)-piperazine
34803-68-4 1-(2-Pyrazinyl)-piperazine
produktnavn |
1-(2-Pyrazinyl)-piperazine |
Synonymer |
1-(2-Pyrazinyl)piperazine; 2-piperazin-1-ylpyrazine; 4-pyrazin-2-ylpiperazin-1-ium |
Molekylær Formel |
C8H13N4 |
Molekylvekt |
165.2151 |
InChI |
InChI=1/C8H12N4/c1-2-11-8(7-10-1)12-5-3-9-4-6-12/h1-2,7,9H,3-6H2/p+1 |
CAS-nummer |
34803-68-4 |
EINECS |
252-221-9 |
Molecular Structure |
|
Kokepunkt |
324.5°C at 760 mmHg |
Flammepunktet |
150°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|