ChemNet > CAS > 3491-63-2 2-Phenyl-2-pentenal
3491-63-2 2-Phenyl-2-pentenal
produktnavn |
2-Phenyl-2-pentenal |
Synonymer |
Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
Molekylær Formel |
C11H12O |
Molekylvekt |
160.2124 |
InChI |
InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
CAS-nummer |
3491-63-2 |
Molecular Structure |
|
Tetthet |
0.976g/cm3 |
Kokepunkt |
286.7°C at 760 mmHg |
Brytningsindeks |
1.524 |
Flammepunktet |
106.2°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|