ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
produktnavn |
2,3,4,6-Tetrafluoropyridine |
Molekylær Formel |
C5HF4N |
Molekylvekt |
151.0618 |
InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
CAS-nummer |
3512-13-8 |
Molecular Structure |
|
Tetthet |
1.518g/cm3 |
Kokepunkt |
114.6°C at 760 mmHg |
Brytningsindeks |
1.403 |
Flammepunktet |
23.1°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|