ChemNet > CAS > 3512-18-3 2,3,6-Trifluoropyridine
3512-18-3 2,3,6-Trifluoropyridine
produktnavn |
2,3,6-Trifluoropyridine |
Molekylær Formel |
C5H2F3N |
Molekylvekt |
133.0713 |
InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
CAS-nummer |
3512-18-3 |
Molecular Structure |
|
Tetthet |
1.396g/cm3 |
Kokepunkt |
123.7°C at 760 mmHg |
Brytningsindeks |
1.424 |
Flammepunktet |
28.6°C |
Hazard symboler |
|
Risiko Koder |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|