ChemNet > CAS > 352018-92-9 5-iodo-2-phenoxypyridine
352018-92-9 5-iodo-2-phenoxypyridine
produktnavn |
5-iodo-2-phenoxypyridine |
Molekylær Formel |
C11H8INO |
Molekylvekt |
297.0918 |
InChI |
InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
CAS-nummer |
352018-92-9 |
Molecular Structure |
|
Tetthet |
1.694g/cm3 |
Kokepunkt |
339.8°C at 760 mmHg |
Brytningsindeks |
1.646 |
Flammepunktet |
159.3°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|