ChemNet > CAS > 3586-14-9 3-Phenoxytoluene
3586-14-9 3-Phenoxytoluene
produktnavn |
3-Phenoxytoluene |
Synonymer |
Phenyl m-tolyl ether; 3-Methyldiphenyl ether; 1-methyl-3-phenoxybenzene |
Molekylær Formel |
C13H12O |
Molekylvekt |
184.2338 |
InChI |
InChI=1/C13H12O/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10H,1H3 |
CAS-nummer |
3586-14-9 |
EINECS |
222-716-4 |
Molecular Structure |
|
Tetthet |
1.045g/cm3 |
Kokepunkt |
269.1°C at 760 mmHg |
Brytningsindeks |
1.566 |
Flammepunktet |
110.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|