ChemNet > CAS > 36283-44-0 (R)-(+)-N-Acetyl-1-methylbenzylamine
36283-44-0 (R)-(+)-N-Acetyl-1-methylbenzylamine
produktnavn |
(R)-(+)-N-Acetyl-1-methylbenzylamine |
Synonymer |
N-[(1R)-1-phenylethyl]acetamide |
Molekylær Formel |
C10H13NO |
Molekylvekt |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m1/s1 |
CAS-nummer |
36283-44-0 |
Molecular Structure |
|
Tetthet |
1.008g/cm3 |
Smeltepunkt |
102℃ |
Kokepunkt |
327.932°C at 760 mmHg |
Brytningsindeks |
1.513 |
Flammepunktet |
192.212°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|