ChemNet > CAS > 368869-96-9 3-(4-bromophenoxy)-6-methylpyridazine
368869-96-9 3-(4-bromophenoxy)-6-methylpyridazine
produktnavn |
3-(4-bromophenoxy)-6-methylpyridazine |
Synonymer |
Ethyl 4-bromo-3,5-dimethyl-1H-pyrrole-2-carboxylate |
Molekylær Formel |
C11H9BrN2O |
Molekylvekt |
265.106 |
InChI |
InChI=1/C11H9BrN2O/c1-8-2-7-11(14-13-8)15-10-5-3-9(12)4-6-10/h2-7H,1H3 |
CAS-nummer |
368869-96-9 |
Molecular Structure |
|
Tetthet |
1.481g/cm3 |
Smeltepunkt |
145℃ |
Kokepunkt |
387.6°C at 760 mmHg |
Brytningsindeks |
1.602 |
Flammepunktet |
188.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|