ChemNet > CAS > 368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
368870-03-5 4-(1H-pyrazol-1-yl)benzylamine
produktnavn |
4-(1H-pyrazol-1-yl)benzylamine |
Synonymer |
1-[4-(1H-pyrazol-1-yl)phenyl]methanamine; 4-(Pyrazol-1-yl)benzylamine |
Molekylær Formel |
C10H11N3 |
Molekylvekt |
173.2144 |
InChI |
InChI=1/C10H11N3/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8,11H2 |
CAS-nummer |
368870-03-5 |
Molecular Structure |
|
Tetthet |
1.16g/cm3 |
Smeltepunkt |
94℃ |
Kokepunkt |
307.1°C at 760 mmHg |
Brytningsindeks |
1.622 |
Flammepunktet |
139.6°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|