ChemNet > CAS > 39620-02-5 5-Bromonicotinoyl chloride
39620-02-5 5-Bromonicotinoyl chloride
| produktnavn |
5-Bromonicotinoyl chloride |
| Synonymer |
5-Bromopyridine-3-carbonyl chloride |
| Molekylær Formel |
C6H3BrClNO |
| Molekylvekt |
220.4511 |
| InChI |
InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
| CAS-nummer |
39620-02-5 |
| Molecular Structure |
|
| Tetthet |
1.76g/cm3 |
| Smeltepunkt |
75℃ |
| Kokepunkt |
265.4°C at 760 mmHg |
| Brytningsindeks |
1.59 |
| Flammepunktet |
114.3°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
