ChemNet > CAS > 399-36-0 2',4'-Difluoroacetanilide
399-36-0 2',4'-Difluoroacetanilide
| produktnavn |
2',4'-Difluoroacetanilide |
| Synonymer |
2,4-Difluoroacetanilide; N-(2,4-difluorophenyl)acetamide |
| Molekylær Formel |
C8H7F2NO |
| Molekylvekt |
171.1441 |
| InChI |
InChI=1/C8H7F2NO/c1-5(12)11-8-3-2-6(9)4-7(8)10/h2-4H,1H3,(H,11,12) |
| CAS-nummer |
399-36-0 |
| Molecular Structure |
|
| Tetthet |
1.307g/cm3 |
| Kokepunkt |
276.8°C at 760 mmHg |
| Brytningsindeks |
1.531 |
| Flammepunktet |
121.2°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
