ChemNet > CAS > 39959-59-6 4-Iodobenzylamine
39959-59-6 4-Iodobenzylamine
| produktnavn |
4-Iodobenzylamine |
| Synonymer |
4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
| Molekylær Formel |
C7H8IN |
| Molekylvekt |
233.0496 |
| InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
| CAS-nummer |
39959-59-6 |
| Molecular Structure |
|
| Tetthet |
1.772g/cm3 |
| Kokepunkt |
250.4°C at 760 mmHg |
| Brytningsindeks |
1.644 |
| Flammepunktet |
105.2°C |
| Hazard symboler |
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
