ChemNet > CAS > 40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
produktnavn |
3,4-Dibromo-2,5-dichlorothiophene |
Molekylær Formel |
C4Br2Cl2S |
Molekylvekt |
310.8218 |
InChI |
InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7 |
CAS-nummer |
40477-45-0 |
Molecular Structure |
|
Tetthet |
2.299g/cm3 |
Kokepunkt |
284.1°C at 760 mmHg |
Brytningsindeks |
1.658 |
Flammepunktet |
125.6°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|