ChemNet > CAS > 40763-96-0 5-Chloro-2-nitrobenzamide
40763-96-0 5-Chloro-2-nitrobenzamide
produktnavn |
5-Chloro-2-nitrobenzamide |
Molekylær Formel |
C7H5ClN2O3 |
Molekylvekt |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
CAS-nummer |
40763-96-0 |
Molecular Structure |
|
Tetthet |
1.52g/cm3 |
Smeltepunkt |
157-160℃ |
Kokepunkt |
301.7°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
136.3°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|