ChemNet > CAS > 40784-88-1 Ethyl 4-ethoxyphenylacetate
40784-88-1 Ethyl 4-ethoxyphenylacetate
produktnavn |
Ethyl 4-ethoxyphenylacetate |
Synonymer |
4-Ethoxyphenylacetic acid ethyl ester |
Molekylær Formel |
C12H16O3 |
Molekylvekt |
208.2536 |
InChI |
InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
CAS-nummer |
40784-88-1 |
Molecular Structure |
|
Tetthet |
1.045g/cm3 |
Kokepunkt |
289.2°C at 760 mmHg |
Brytningsindeks |
1.495 |
Flammepunktet |
116.8°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|