ChemNet > CAS > 4079-52-1 2-Methoxyacetophenone
4079-52-1 2-Methoxyacetophenone
| produktnavn |
2-Methoxyacetophenone |
| Synonymer |
2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
| Molekylær Formel |
C9H10O2 |
| Molekylvekt |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
| CAS-nummer |
4079-52-1 |
| EINECS |
223-802-4 |
| Molecular Structure |
|
| Tetthet |
1.035g/cm3 |
| Smeltepunkt |
7-8℃ |
| Kokepunkt |
245°C at 760 mmHg |
| Brytningsindeks |
1.504 |
| Flammepunktet |
92.8°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
