ChemNet > CAS > 4250-77-5 6-Hydroxyflavanone
4250-77-5 6-Hydroxyflavanone
| produktnavn |
6-Hydroxyflavanone |
| Synonymer |
(2R)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; 6-hydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Molekylær Formel |
C15H12O3 |
| Molekylvekt |
240.254 |
| InChI |
InChI=1/C15H12O3/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-8,15-16H,9H2 |
| CAS-nummer |
4250-77-5 |
| Molecular Structure |
|
| Tetthet |
1.288g/cm3 |
| Smeltepunkt |
220-222℃ |
| Kokepunkt |
464.3°C at 760 mmHg |
| Brytningsindeks |
1.631 |
| Flammepunktet |
181.2°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
