ChemNet > CAS > 4358-86-5;4410-31-5 DL-Mandelamide
4358-86-5;4410-31-5 DL-Mandelamide
produktnavn |
DL-Mandelamide |
Synonymer |
Mandelamide; NSC 16603; Benzeneacetamide, alpha-hydroxy-; 2-hydroxy-2-phenylacetamide |
Molekylær Formel |
C8H9NO2 |
Molekylvekt |
151.1626 |
InChI |
InChI=1/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) |
CAS-nummer |
4358-86-5;4410-31-5 |
Molecular Structure |
|
Tetthet |
1.246g/cm3 |
Kokepunkt |
345.5°C at 760 mmHg |
Brytningsindeks |
1.589 |
Flammepunktet |
162.7°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|