ChemNet > CAS > 4441-01-4 1,2,4-Triphenyl-1,4-butanedione
4441-01-4 1,2,4-Triphenyl-1,4-butanedione
produktnavn |
1,2,4-Triphenyl-1,4-butanedione |
Synonymer |
1,4-Butanedione, 1,2,4-triphenyl-; AI3-17642; NSC 7759; 1,2,4-triphenylbutane-1,4-dione; (2S)-1,2,4-triphenylbutane-1,4-dione; (2R)-1,2,4-triphenylbutane-1,4-dione |
Molekylær Formel |
C22H18O2 |
Molekylvekt |
314.3771 |
InChI |
InChI=1/C22H18O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m1/s1 |
CAS-nummer |
4441-01-4 |
Molecular Structure |
|
Tetthet |
1.143g/cm3 |
Kokepunkt |
496.2°C at 760 mmHg |
Brytningsindeks |
1.607 |
Flammepunktet |
183.6°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|