ChemNet > CAS > 44520-55-0 D(-)-Threoninol
44520-55-0 D(-)-Threoninol
| produktnavn |
D(-)-Threoninol |
| Synonymer |
(2R,3R)-2-Amino-1,3-butanediol; D-Threoninol; (2R,3R)-1,3-dihydroxybutan-2-aminium; (2S,3S)-1,3-dihydroxybutan-2-aminium; (2S,3S)-2-aminobutane-1,3-diol |
| Molekylær Formel |
C4H11NO2 |
| Molekylvekt |
105.1356 |
| InChI |
InChI=1/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
| CAS-nummer |
44520-55-0 |
| Molecular Structure |
|
| Tetthet |
1.118g/cm3 |
| Smeltepunkt |
57.5-61.5℃ |
| Kokepunkt |
257.8°C at 760 mmHg |
| Brytningsindeks |
1.488 |
| Flammepunktet |
109.7°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
